C17H17N7O2S — CID 118339554
(5Z)-5-[[4-(4-pyridin-4-yl-1,4-diazepan-1-yl)-1,3,5-triazin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118339554) has the molecular formula C17H17N7O2S and a molecular weight of 383.44 g/mol. Its IUPAC name is (5Z)-5-[[4-(4-pyridin-4-yl-1,4-diazepan-1-yl)-1,3,5-triazin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-(4-pyridin-4-yl-1,4-diazepan-1-yl)-1,3,5-triazin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118339554 |
| Molecular Formula | C17H17N7O2S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (5Z)-5-[[4-(4-pyridin-4-yl-1,4-diazepan-1-yl)-1,3,5-triazin-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ncnc(N3CCCN(c4ccncc4)CC3)n2)S1 |
| InChI | InChI=1S/C17H17N7O2S/c25-15-13(27-17(26)22-15)10-14-19-11-20-16(21-14)24-7-1-6-23(8-9-24)12-2-4-18-5-3-12/h2-5,10-11H,1,6-9H2,(H,22,25,26)/b13-10- |
| InChIKey | FUMXAIQDQVWYJU-RAXLEYEMSA-N |
| XLogP | 1.31 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|