C18H18N6O2S — CID 58312902
(5Z)-3-methyl-5-[[2-(4-pyridin-4-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58312902) has the molecular formula C18H18N6O2S and a molecular weight of 382.45 g/mol. Its IUPAC name is (5Z)-3-methyl-5-[[2-(4-pyridin-4-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-methyl-5-[[2-(4-pyridin-4-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58312902 |
| Molecular Formula | C18H18N6O2S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (5Z)-3-methyl-5-[[2-(4-pyridin-4-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1C(=O)S/C(=C\c2ccnc(N3CCN(c4ccncc4)CC3)n2)C1=O |
| InChI | InChI=1S/C18H18N6O2S/c1-22-16(25)15(27-18(22)26)12-13-2-7-20-17(21-13)24-10-8-23(9-11-24)14-3-5-19-6-4-14/h2-7,12H,8-11H2,1H3/b15-12- |
| InChIKey | PLZGJCLPYWXSQP-QINSGFPZSA-N |
| XLogP | 1.86 |
| TPSA | 82.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|