C16H21N5O2S — CID 76756753
3-methyl-5-[[2-(4-propan-2-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 76756753) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 3-methyl-5-[[2-(4-propan-2-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-methyl-5-[[2-(4-propan-2-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 76756753 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-methyl-5-[[2-(4-propan-2-ylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)N1CCN(c2nccc(C=C3SC(=O)N(C)C3=O)n2)CC1 |
| InChI | InChI=1S/C16H21N5O2S/c1-11(2)20-6-8-21(9-7-20)15-17-5-4-12(18-15)10-13-14(22)19(3)16(23)24-13/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | SYJKDLCMGCVPFZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|