C22H24N6O3S — CID 118339504
(5Z)-5-[[6-morpholin-4-yl-2-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118339504) has the molecular formula C22H24N6O3S and a molecular weight of 452.54 g/mol. Its IUPAC name is (5Z)-5-[[6-morpholin-4-yl-2-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[6-morpholin-4-yl-2-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118339504 |
| Molecular Formula | C22H24N6O3S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | (5Z)-5-[[6-morpholin-4-yl-2-(4-phenylpiperazin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc(N3CCOCC3)nc(N3CCN(c4ccccc4)CC3)n2)S1 |
| InChI | InChI=1S/C22H24N6O3S/c29-20-18(32-22(30)25-20)14-16-15-19(27-10-12-31-13-11-27)24-21(23-16)28-8-6-26(7-9-28)17-4-2-1-3-5-17/h1-5,14-15H,6-13H2,(H,25,29,30)/b18-14- |
| InChIKey | HUNFISUSDMGMTG-JXAWBTAJSA-N |
| XLogP | 1.96 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|