C25H23N5O5S2 — CID 118339268
(5Z)-5-[[2-[4-(benzenesulfonyl)piperazin-1-yl]-6-phenylmethoxypyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118339268) has the molecular formula C25H23N5O5S2 and a molecular weight of 537.62 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-(benzenesulfonyl)piperazin-1-yl]-6-phenylmethoxypyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-(benzenesulfonyl)piperazin-1-yl]-6-phenylmethoxypyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118339268 |
| Molecular Formula | C25H23N5O5S2 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | (5Z)-5-[[2-[4-(benzenesulfonyl)piperazin-1-yl]-6-phenylmethoxypyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc(OCc3ccccc3)nc(N3CCN(S(=O)(=O)c4ccccc4)CC3)n2)S1 |
| InChI | InChI=1S/C25H23N5O5S2/c31-23-21(36-25(32)28-23)15-19-16-22(35-17-18-7-3-1-4-8-18)27-24(26-19)29-11-13-30(14-12-29)37(33,34)20-9-5-2-6-10-20/h1-10,15-16H,11-14,17H2,(H,28,31,32)/b21-15- |
| InChIKey | KDENUGUKAWJETN-QNGOZBTKSA-N |
| XLogP | 2.89 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|