C23H26N6O4S — CID 118339364
(5Z)-5-[[2-(4-benzoylpiperazin-1-yl)-6-[2-(dimethylamino)ethoxy]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118339364) has the molecular formula C23H26N6O4S and a molecular weight of 482.57 g/mol. Its IUPAC name is (5Z)-5-[[2-(4-benzoylpiperazin-1-yl)-6-[2-(dimethylamino)ethoxy]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-(4-benzoylpiperazin-1-yl)-6-[2-(dimethylamino)ethoxy]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118339364 |
| Molecular Formula | C23H26N6O4S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (5Z)-5-[[2-(4-benzoylpiperazin-1-yl)-6-[2-(dimethylamino)ethoxy]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(C)CCOc1cc(/C=C2\SC(=O)NC2=O)nc(N2CCN(C(=O)c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C23H26N6O4S/c1-27(2)12-13-33-19-15-17(14-18-20(30)26-23(32)34-18)24-22(25-19)29-10-8-28(9-11-29)21(31)16-6-4-3-5-7-16/h3-7,14-15H,8-13H2,1-2H3,(H,26,30,32)/b18-14- |
| InChIKey | XVBJAWQLGYLBNB-JXAWBTAJSA-N |
| XLogP | 1.70 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|