C26H22N6O4S — CID 118339271
6-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-phenoxypyrimidin-2-yl]-N-phenyl-2,6-diazaspiro[3.3]heptane-2-carboxamide (PubChem CID 118339271) has the molecular formula C26H22N6O4S and a molecular weight of 514.57 g/mol. Its IUPAC name is 6-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-phenoxypyrimidin-2-yl]-N-phenyl-2,6-diazaspiro[3.3]heptane-2-carboxamide.
| Compound Name | 6-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-phenoxypyrimidin-2-yl]-N-phenyl-2,6-diazaspiro[3.3]heptane-2-carboxamide |
|---|---|
| PubChem CID | 118339271 |
| Molecular Formula | C26H22N6O4S |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 6-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-phenoxypyrimidin-2-yl]-N-phenyl-2,6-diazaspiro[3.3]heptane-2-carboxamide |
| SMILES | O=C1NC(=O)/C(=C\c2cc(Oc3ccccc3)nc(N3CC4(CN(C(=O)Nc5ccccc5)C4)C3)n2)S1 |
| InChI | InChI=1S/C26H22N6O4S/c33-22-20(37-25(35)30-22)11-18-12-21(36-19-9-5-2-6-10-19)29-23(27-18)31-13-26(14-31)15-32(16-26)24(34)28-17-7-3-1-4-8-17/h1-12H,13-16H2,(H,28,34)(H,30,33,35)/b20-11+ |
| InChIKey | RBZCWCATHUKEOY-RGVLZGJSSA-N |
| XLogP | 3.95 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|