C27H27N7O3S — CID 123964273
4-[4-[benzyl(methyl)amino]-6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]-N-phenylpiperazine-1-carboxamide (PubChem CID 123964273) has the molecular formula C27H27N7O3S and a molecular weight of 529.63 g/mol. Its IUPAC name is 4-[4-[benzyl(methyl)amino]-6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[4-[benzyl(methyl)amino]-6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 123964273 |
| Molecular Formula | C27H27N7O3S |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 4-[4-[benzyl(methyl)amino]-6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]-N-phenylpiperazine-1-carboxamide |
| SMILES | CN(Cc1ccccc1)c1cc(C=C2SC(=O)NC2=O)nc(N2CCN(C(=O)Nc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C27H27N7O3S/c1-32(18-19-8-4-2-5-9-19)23-17-21(16-22-24(35)31-27(37)38-22)28-25(30-23)33-12-14-34(15-13-33)26(36)29-20-10-6-3-7-11-20/h2-11,16-17H,12-15,18H2,1H3,(H,29,36)(H,31,35,37) |
| InChIKey | GOQBLZQEYDBYME-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|