C26H23N7O3S — CID 136999988
(5Z)-5-[[6-[benzyl(methyl)amino]-2-[2-(4-oxo-3H-quinazolin-2-yl)ethylamino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 136999988) has the molecular formula C26H23N7O3S and a molecular weight of 513.58 g/mol. Its IUPAC name is (5Z)-5-[[6-[benzyl(methyl)amino]-2-[2-(4-oxo-3H-quinazolin-2-yl)ethylamino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[6-[benzyl(methyl)amino]-2-[2-(4-oxo-3H-quinazolin-2-yl)ethylamino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 136999988 |
| Molecular Formula | C26H23N7O3S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | (5Z)-5-[[6-[benzyl(methyl)amino]-2-[2-(4-oxo-3H-quinazolin-2-yl)ethylamino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(Cc1ccccc1)c1cc(/C=C2\SC(=O)NC2=O)nc(NCCc2nc3ccccc3c(=O)[nH]2)n1 |
| InChI | InChI=1S/C26H23N7O3S/c1-33(15-16-7-3-2-4-8-16)22-14-17(13-20-24(35)32-26(36)37-20)28-25(31-22)27-12-11-21-29-19-10-6-5-9-18(19)23(34)30-21/h2-10,13-14H,11-12,15H2,1H3,(H,27,28,31)(H,29,30,34)(H,32,35,36)/b20-13- |
| InChIKey | HWHOMFNFYBPBCG-MOSHPQCFSA-N |
| XLogP | 3.33 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|