C27H24N6O4S — CID 118339700
2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-phenoxypyrimidin-2-yl]-N-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 118339700) has the molecular formula C27H24N6O4S and a molecular weight of 528.59 g/mol. Its IUPAC name is 2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-phenoxypyrimidin-2-yl]-N-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | 2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-phenoxypyrimidin-2-yl]-N-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 118339700 |
| Molecular Formula | C27H24N6O4S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-phenoxypyrimidin-2-yl]-N-phenyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | O=C1NC(=O)/C(=C/c2cc(Oc3ccccc3)nc(N3CC4CN(C(=O)Nc5ccccc5)CC4C3)n2)S1 |
| InChI | InChI=1S/C27H24N6O4S/c34-24-22(38-27(36)31-24)11-20-12-23(37-21-9-5-2-6-10-21)30-25(28-20)32-13-17-15-33(16-18(17)14-32)26(35)29-19-7-3-1-4-8-19/h1-12,17-18H,13-16H2,(H,29,35)(H,31,34,36)/b22-11- |
| InChIKey | GEBBJXNEFNQTJG-JJFYIABZSA-N |
| XLogP | 4.19 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|