C24H24N6O4S — CID 118339564
(5Z)-5-[[2-(2-benzoyl-2,6-diazaspiro[3.3]heptan-6-yl)-6-morpholin-4-ylpyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118339564) has the molecular formula C24H24N6O4S and a molecular weight of 492.56 g/mol. Its IUPAC name is (5Z)-5-[[2-(2-benzoyl-2,6-diazaspiro[3.3]heptan-6-yl)-6-morpholin-4-ylpyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-(2-benzoyl-2,6-diazaspiro[3.3]heptan-6-yl)-6-morpholin-4-ylpyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118339564 |
| Molecular Formula | C24H24N6O4S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (5Z)-5-[[2-(2-benzoyl-2,6-diazaspiro[3.3]heptan-6-yl)-6-morpholin-4-ylpyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc(N3CCOCC3)nc(N3CC4(CN(C(=O)c5ccccc5)C4)C3)n2)S1 |
| InChI | InChI=1S/C24H24N6O4S/c31-20-18(35-23(33)27-20)10-17-11-19(28-6-8-34-9-7-28)26-22(25-17)30-14-24(15-30)12-29(13-24)21(32)16-4-2-1-3-5-16/h1-5,10-11H,6-9,12-15H2,(H,27,31,33)/b18-10- |
| InChIKey | SGXWNMNPTZROOE-ZDLGFXPLSA-N |
| XLogP | 1.60 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|