C22H23N5O6S2 — CID 118339744
(5Z)-5-[[2-[2-(benzenesulfonyl)-2,6-diazaspiro[3.3]heptan-6-yl]-6-(2-methoxyethoxy)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118339744) has the molecular formula C22H23N5O6S2 and a molecular weight of 517.59 g/mol. Its IUPAC name is (5Z)-5-[[2-[2-(benzenesulfonyl)-2,6-diazaspiro[3.3]heptan-6-yl]-6-(2-methoxyethoxy)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[2-(benzenesulfonyl)-2,6-diazaspiro[3.3]heptan-6-yl]-6-(2-methoxyethoxy)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118339744 |
| Molecular Formula | C22H23N5O6S2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | (5Z)-5-[[2-[2-(benzenesulfonyl)-2,6-diazaspiro[3.3]heptan-6-yl]-6-(2-methoxyethoxy)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COCCOc1cc(/C=C2\SC(=O)NC2=O)nc(N2CC3(C2)CN(S(=O)(=O)c2ccccc2)C3)n1 |
| InChI | InChI=1S/C22H23N5O6S2/c1-32-7-8-33-18-10-15(9-17-19(28)25-21(29)34-17)23-20(24-18)26-11-22(12-26)13-27(14-22)35(30,31)16-5-3-2-4-6-16/h2-6,9-10H,7-8,11-14H2,1H3,(H,25,28,29)/b17-9- |
| InChIKey | YZNBMIXBYBBWJS-MFOYZWKCSA-N |
| XLogP | 1.34 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|