C20H21N5O5S — CID 118339261
N-[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(2-methoxyethoxy)pyrimidin-2-yl]amino]ethyl]benzamide (PubChem CID 118339261) has the molecular formula C20H21N5O5S and a molecular weight of 443.49 g/mol. Its IUPAC name is N-[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(2-methoxyethoxy)pyrimidin-2-yl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(2-methoxyethoxy)pyrimidin-2-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 118339261 |
| Molecular Formula | C20H21N5O5S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(2-methoxyethoxy)pyrimidin-2-yl]amino]ethyl]benzamide |
| SMILES | COCCOc1cc(/C=C2/SC(=O)NC2=O)nc(NCCNC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C20H21N5O5S/c1-29-9-10-30-16-12-14(11-15-18(27)25-20(28)31-15)23-19(24-16)22-8-7-21-17(26)13-5-3-2-4-6-13/h2-6,11-12H,7-10H2,1H3,(H,21,26)(H,22,23,24)(H,25,27,28)/b15-11+ |
| InChIKey | LXVSNVYVQXSECF-RVDMUPIBSA-N |
| XLogP | 1.67 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|