C20H22N6O4S — CID 118339352
N-[2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-[2-hydroxyethyl(methyl)amino]pyrimidin-2-yl]amino]ethyl]benzamide (PubChem CID 118339352) has the molecular formula C20H22N6O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-[2-hydroxyethyl(methyl)amino]pyrimidin-2-yl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-[2-hydroxyethyl(methyl)amino]pyrimidin-2-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 118339352 |
| Molecular Formula | C20H22N6O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | N-[2-[[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-[2-hydroxyethyl(methyl)amino]pyrimidin-2-yl]amino]ethyl]benzamide |
| SMILES | CN(CCO)c1cc(/C=C2\SC(=O)NC2=O)nc(NCCNC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C20H22N6O4S/c1-26(9-10-27)16-12-14(11-15-18(29)25-20(30)31-15)23-19(24-16)22-8-7-21-17(28)13-5-3-2-4-6-13/h2-6,11-12,27H,7-10H2,1H3,(H,21,28)(H,22,23,24)(H,25,29,30)/b15-11- |
| InChIKey | NUYYIZPFJAMCIR-PTNGSMBKSA-N |
| XLogP | 1.07 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|