C22H19N5O5S — CID 118339535
N-[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(furan-2-ylmethoxy)pyrimidin-2-yl]amino]ethyl]benzamide (PubChem CID 118339535) has the molecular formula C22H19N5O5S and a molecular weight of 465.49 g/mol. Its IUPAC name is N-[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(furan-2-ylmethoxy)pyrimidin-2-yl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(furan-2-ylmethoxy)pyrimidin-2-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 118339535 |
| Molecular Formula | C22H19N5O5S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N-[2-[[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(furan-2-ylmethoxy)pyrimidin-2-yl]amino]ethyl]benzamide |
| SMILES | O=C1NC(=O)/C(=C\c2cc(OCc3ccco3)nc(NCCNC(=O)c3ccccc3)n2)S1 |
| InChI | InChI=1S/C22H19N5O5S/c28-19(14-5-2-1-3-6-14)23-8-9-24-21-25-15(11-17-20(29)27-22(30)33-17)12-18(26-21)32-13-16-7-4-10-31-16/h1-7,10-12H,8-9,13H2,(H,23,28)(H,24,25,26)(H,27,29,30)/b17-11+ |
| InChIKey | VVYJQKORCZETRX-GZTJUZNOSA-N |
| XLogP | 2.81 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|