C13H8N4O4S — CID 123929624
N-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]furan-2-carboxamide (PubChem CID 123929624) has the molecular formula C13H8N4O4S and a molecular weight of 316.30 g/mol. Its IUPAC name is N-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]furan-2-carboxamide.
| Compound Name | N-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 123929624 |
| Molecular Formula | C13H8N4O4S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | N-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]furan-2-carboxamide |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(NC(=O)c3ccco3)n2)S1 |
| InChI | InChI=1S/C13H8N4O4S/c18-10(8-2-1-5-21-8)16-12-14-4-3-7(15-12)6-9-11(19)17-13(20)22-9/h1-6H,(H,17,19,20)(H,14,15,16,18) |
| InChIKey | SYAKBGLEKZCGCZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|