C13H11N3O3 — CID 943501
N-(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)furan-2-carboxamide (PubChem CID 943501) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is N-(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)furan-2-carboxamide.
| Compound Name | N-(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 943501 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1ncc2c(n1)CCCC2=O)c1ccco1 |
| InChI | InChI=1S/C13H11N3O3/c17-10-4-1-3-9-8(10)7-14-13(15-9)16-12(18)11-5-2-6-19-11/h2,5-7H,1,3-4H2,(H,14,15,16,18) |
| InChIKey | PPJLGTXPPYMJKH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |