C19H20N6O3S — CID 66571664
N'-[[1-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-4-yl]methyl]furan-2-carboximidamide (PubChem CID 66571664) has the molecular formula C19H20N6O3S and a molecular weight of 412.48 g/mol. Its IUPAC name is N'-[[1-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-4-yl]methyl]furan-2-carboximidamide.
| Compound Name | N'-[[1-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-4-yl]methyl]furan-2-carboximidamide |
|---|---|
| PubChem CID | 66571664 |
| Molecular Formula | C19H20N6O3S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N'-[[1-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-4-yl]methyl]furan-2-carboximidamide |
| SMILES | N/C(=N\CC1CCN(c2nccc(/C=C3\SC(=O)NC3=O)n2)CC1)c1ccco1 |
| InChI | InChI=1S/C19H20N6O3S/c20-16(14-2-1-9-28-14)22-11-12-4-7-25(8-5-12)18-21-6-3-13(23-18)10-15-17(26)24-19(27)29-15/h1-3,6,9-10,12H,4-5,7-8,11H2,(H2,20,22)(H,24,26,27)/b15-10- |
| InChIKey | FQTRZIQAYPYECV-GDNBJRDFSA-N |
| XLogP | 2.02 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|