C24H30N6O4S — CID 118339626
(5Z)-5-[[2-[4-(1-ethylpiperidin-4-yl)piperazin-1-yl]-6-(furan-2-ylmethoxy)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 118339626) has the molecular formula C24H30N6O4S and a molecular weight of 498.61 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-(1-ethylpiperidin-4-yl)piperazin-1-yl]-6-(furan-2-ylmethoxy)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-(1-ethylpiperidin-4-yl)piperazin-1-yl]-6-(furan-2-ylmethoxy)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 118339626 |
| Molecular Formula | C24H30N6O4S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | (5Z)-5-[[2-[4-(1-ethylpiperidin-4-yl)piperazin-1-yl]-6-(furan-2-ylmethoxy)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCN1CCC(N2CCN(c3nc(/C=C4\SC(=O)NC4=O)cc(OCc4ccco4)n3)CC2)CC1 |
| InChI | InChI=1S/C24H30N6O4S/c1-2-28-7-5-18(6-8-28)29-9-11-30(12-10-29)23-25-17(14-20-22(31)27-24(32)35-20)15-21(26-23)34-16-19-4-3-13-33-19/h3-4,13-15,18H,2,5-12,16H2,1H3,(H,27,31,32)/b20-14- |
| InChIKey | GNVZZIZRNWULMN-ZHZULCJRSA-N |
| XLogP | 2.58 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|