C15H19N5O3S — CID 87310956
(5E)-5-[[2-[4-(aminomethyl)piperidin-1-yl]-6-methoxypyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87310956) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is (5E)-5-[[2-[4-(aminomethyl)piperidin-1-yl]-6-methoxypyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[4-(aminomethyl)piperidin-1-yl]-6-methoxypyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87310956 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (5E)-5-[[2-[4-(aminomethyl)piperidin-1-yl]-6-methoxypyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)NC2=O)nc(N2CCC(CN)CC2)n1 |
| InChI | InChI=1S/C15H19N5O3S/c1-23-12-7-10(6-11-13(21)19-15(22)24-11)17-14(18-12)20-4-2-9(8-16)3-5-20/h6-7,9H,2-5,8,16H2,1H3,(H,19,21,22)/b11-6+ |
| InChIKey | QLSRQRZBHZOMJZ-IZZDOVSWSA-N |
| XLogP | 0.98 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|