About (4-bromophenyl) selenohypobromite
(4-bromophenyl) selenohypobromite (PubChem CID 11834013) has the molecular formula C6H4Br2Se
and a molecular weight of 314.87 g/mol. Its IUPAC name is (4-bromophenyl) selenohypobromite.
Molecular Properties
| Compound Name | (4-bromophenyl) selenohypobromite |
| PubChem CID | 11834013 |
| Molecular Formula | C6H4Br2Se |
| Molecular Weight | 314.87 g/mol |
| Exact Mass | 313.78 |
| IUPAC Name | (4-bromophenyl) selenohypobromite |
| SMILES | Br[Se]c1ccc(Br)cc1 |
| InChI | InChI=1S/C6H4Br2Se/c7-5-1-3-6(9-8)4-2-5/h1-4H |
| InChIKey | PTNDXAVDVBHCIM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.87 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl) selenohypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl) selenohypobromite?
The IUPAC name of (4-bromophenyl) selenohypobromite (CID 11834013) is (4-bromophenyl) selenohypobromite.
What is the SMILES notation for (4-bromophenyl) selenohypobromite?
The canonical SMILES for (4-bromophenyl) selenohypobromite is Br[Se]c1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl) selenohypobromite?
The InChIKey is PTNDXAVDVBHCIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Br2Se/c7-5-1-3-6(9-8)4-2-5/h1-4H.
What are the key properties of (4-bromophenyl) selenohypobromite?
(4-bromophenyl) selenohypobromite has a molecular weight of 314.87 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl) selenohypobromite is sourced from PubChem (CID 11834013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).