C10H13F2NO — CID 118342449
2,3-difluoro-4-methoxy-N-propan-2-ylaniline (PubChem CID 118342449) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 2,3-difluoro-4-methoxy-N-propan-2-ylaniline.
| Compound Name | 2,3-difluoro-4-methoxy-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 118342449 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2,3-difluoro-4-methoxy-N-propan-2-ylaniline |
| SMILES | COc1ccc(NC(C)C)c(F)c1F |
| InChI | InChI=1S/C10H13F2NO/c1-6(2)13-7-4-5-8(14-3)10(12)9(7)11/h4-6,13H,1-3H3 |
| InChIKey | GVAFJBKXBKYICU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|