C8H9F2NO2 — CID 176996753
2,3-difluoro-N,4-dimethoxyaniline (PubChem CID 176996753) has the molecular formula C8H9F2NO2 and a molecular weight of 189.16 g/mol. Its IUPAC name is 2,3-difluoro-N,4-dimethoxyaniline.
| Compound Name | 2,3-difluoro-N,4-dimethoxyaniline |
|---|---|
| PubChem CID | 176996753 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2,3-difluoro-N,4-dimethoxyaniline |
| SMILES | CONc1ccc(OC)c(F)c1F |
| InChI | InChI=1S/C8H9F2NO2/c1-12-6-4-3-5(11-13-2)7(9)8(6)10/h3-4,11H,1-2H3 |
| InChIKey | DHRBUOGCTVEGHM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|