C11H16ClNO2 — CID 83953548
2-chloro-3,4-dimethoxy-N-propan-2-ylaniline (PubChem CID 83953548) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-chloro-3,4-dimethoxy-N-propan-2-ylaniline.
| Compound Name | 2-chloro-3,4-dimethoxy-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 83953548 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-chloro-3,4-dimethoxy-N-propan-2-ylaniline |
| SMILES | COc1ccc(NC(C)C)c(Cl)c1OC |
| InChI | InChI=1S/C11H16ClNO2/c1-7(2)13-8-5-6-9(14-3)11(15-4)10(8)12/h5-7,13H,1-4H3 |
| InChIKey | PHEBDHORNCUZKM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|