About cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline
cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline (PubChem CID 118342640) has the molecular formula C18H26FNO
and a molecular weight of 291.41 g/mol. Its IUPAC name is cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline.
Molecular Properties
| Compound Name | cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline |
| PubChem CID | 118342640 |
| Molecular Formula | C18H26FNO |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline |
| SMILES | CCc1ccc(NC2CCCC2)cc1F.O=C1CCCC1 |
| InChI | InChI=1S/C13H18FN.C5H8O/c1-2-10-7-8-12(9-13(10)14)15-11-5-3-4-6-11;6-5-3-1-2-4-5/h7-9,11,15H,2-6H2,1H3;1-4H2 |
| InChIKey | YRXPTFJHQAPXAA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline?
The IUPAC name of cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline (CID 118342640) is cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline.
What is the SMILES notation for cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline?
The canonical SMILES for cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline is CCc1ccc(NC2CCCC2)cc1F.O=C1CCCC1.
What is the InChIKey of cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline?
The InChIKey is YRXPTFJHQAPXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FN.C5H8O/c1-2-10-7-8-12(9-13(10)14)15-11-5-3-4-6-11;6-5-3-1-2-4-5/h7-9,11,15H,2-6H2,1H3;1-4H2.
What are the key properties of cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline?
cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline has a molecular weight of 291.41 g/mol, XLogP of 4.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanone;N-cyclopentyl-4-ethyl-3-fluoroaniline is sourced from PubChem (CID 118342640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).