C59H60N2S2 — CID 118345757
2-fluoranthen-2-yl-4-(7-methyl-9,9-dioctylfluoren-2-yl)-6-[5-(5-methylthiophen-2-yl)thiophen-2-yl]pyrimidine (PubChem CID 118345757) has the molecular formula C59H60N2S2 and a molecular weight of 861.28 g/mol. Its IUPAC name is 2-fluoranthen-2-yl-4-(7-methyl-9,9-dioctylfluoren-2-yl)-6-[5-(5-methylthiophen-2-yl)thiophen-2-yl]pyrimidine.
| Compound Name | 2-fluoranthen-2-yl-4-(7-methyl-9,9-dioctylfluoren-2-yl)-6-[5-(5-methylthiophen-2-yl)thiophen-2-yl]pyrimidine |
|---|---|
| PubChem CID | 118345757 |
| Molecular Formula | C59H60N2S2 |
| Molecular Weight | 861.28 g/mol |
| Exact Mass | 860.42 |
| IUPAC Name | 2-fluoranthen-2-yl-4-(7-methyl-9,9-dioctylfluoren-2-yl)-6-[5-(5-methylthiophen-2-yl)thiophen-2-yl]pyrimidine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3cc(-c4ccc(-c5ccc(C)s5)s4)nc(-c4cc5c6c(cccc6c4)-c4ccccc4-5)n3)cc21 |
| InChI | InChI=1S/C59H60N2S2/c1-5-7-9-11-13-17-32-59(33-18-14-12-10-8-6-2)50-34-39(3)24-27-46(50)47-28-26-41(37-51(47)59)52-38-53(54-30-31-56(63-54)55-29-25-40(4)62-55)61-58(60-52)43-35-42-20-19-23-48-44-21-15-16-22-45(44)49(36-43)57(42)48/h15-16,19-31,34-38H,5-14,17-18,32-33H2,1-4H3 |
| InChIKey | ZOYDFSRURNMCLU-UHFFFAOYSA-N |
| XLogP | 18.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.28 |
| LogP ≤ 5 | 18.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|