About 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide
4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide (PubChem CID 118347370) has the molecular formula C13H20N8O2
and a molecular weight of 320.36 g/mol. Its IUPAC name is 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide |
| PubChem CID | 118347370 |
| Molecular Formula | C13H20N8O2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCNc1c(C(=O)Nc2nnnn2C)nn(C)c(=O)c1C |
| InChI | InChI=1S/C13H20N8O2/c1-5-6-7-14-9-8(2)12(23)20(3)17-10(9)11(22)15-13-16-18-19-21(13)4/h14H,5-7H2,1-4H3,(H,15,16,19,22) |
| InChIKey | IMQMRSWAKJWRHA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide?
The IUPAC name of 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide (CID 118347370) is 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide.
What is the SMILES notation for 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide?
The canonical SMILES for 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide is CCCCNc1c(C(=O)Nc2nnnn2C)nn(C)c(=O)c1C.
What is the InChIKey of 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide?
The InChIKey is IMQMRSWAKJWRHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N8O2/c1-5-6-7-14-9-8(2)12(23)20(3)17-10(9)11(22)15-13-16-18-19-21(13)4/h14H,5-7H2,1-4H3,(H,15,16,19,22).
What are the key properties of 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide?
4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide has a molecular weight of 320.36 g/mol, XLogP of 0.08, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butylamino)-1,5-dimethyl-N-(1-methyltetrazol-5-yl)-6-oxopyridazine-3-carboxamide is sourced from PubChem (CID 118347370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).