C20H21ClF3NO — CID 118349183
[5-[1-[4-chloro-N-ethyl-3-(trifluoromethyl)anilino]ethyl]-2-ethenylphenyl]methanol (PubChem CID 118349183) has the molecular formula C20H21ClF3NO and a molecular weight of 383.84 g/mol. Its IUPAC name is [5-[1-[4-chloro-N-ethyl-3-(trifluoromethyl)anilino]ethyl]-2-ethenylphenyl]methanol.
| Compound Name | [5-[1-[4-chloro-N-ethyl-3-(trifluoromethyl)anilino]ethyl]-2-ethenylphenyl]methanol |
|---|---|
| PubChem CID | 118349183 |
| Molecular Formula | C20H21ClF3NO |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | [5-[1-[4-chloro-N-ethyl-3-(trifluoromethyl)anilino]ethyl]-2-ethenylphenyl]methanol |
| SMILES | C=Cc1ccc(C(C)N(CC)c2ccc(Cl)c(C(F)(F)F)c2)cc1CO |
| InChI | InChI=1S/C20H21ClF3NO/c1-4-14-6-7-15(10-16(14)12-26)13(3)25(5-2)17-8-9-19(21)18(11-17)20(22,23)24/h4,6-11,13,26H,1,5,12H2,2-3H3 |
| InChIKey | RXPLFLYHLRZJJS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |