C19H37NO8 — CID 118351233
N-[(5R)-5-methyl-6-oxoheptyl]-5-(1,2,3,4,6-pentahydroxyhexoxy)pentanamide (PubChem CID 118351233) has the molecular formula C19H37NO8 and a molecular weight of 407.50 g/mol. Its IUPAC name is N-[(5R)-5-methyl-6-oxoheptyl]-5-(1,2,3,4,6-pentahydroxyhexoxy)pentanamide.
| Compound Name | N-[(5R)-5-methyl-6-oxoheptyl]-5-(1,2,3,4,6-pentahydroxyhexoxy)pentanamide |
|---|---|
| PubChem CID | 118351233 |
| Molecular Formula | C19H37NO8 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | N-[(5R)-5-methyl-6-oxoheptyl]-5-(1,2,3,4,6-pentahydroxyhexoxy)pentanamide |
| SMILES | CC(=O)[C@H](C)CCCCNC(=O)CCCCOC(O)C(O)C(O)C(O)CCO |
| InChI | InChI=1S/C19H37NO8/c1-13(14(2)22)7-3-5-10-20-16(24)8-4-6-12-28-19(27)18(26)17(25)15(23)9-11-21/h13,15,17-19,21,23,25-27H,3-12H2,1-2H3,(H,20,24)/t13-,15?,17?,18?,19?/m1/s1 |
| InChIKey | OOWICLKMUXOYNO-FEISOSAJSA-N |
| XLogP | -0.53 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|