C30H58N2O14 — CID 146352037
N-[(5R)-6-oxo-5-[5-(1,2,3,4,6-pentahydroxyhexoxy)pentanoylamino]heptyl]-5-(1,2,4,6-tetrahydroxy-3-methylhexoxy)pentanamide (PubChem CID 146352037) has the molecular formula C30H58N2O14 and a molecular weight of 670.79 g/mol. Its IUPAC name is N-[(5R)-6-oxo-5-[5-(1,2,3,4,6-pentahydroxyhexoxy)pentanoylamino]heptyl]-5-(1,2,4,6-tetrahydroxy-3-methylhexoxy)pentanamide.
| Compound Name | N-[(5R)-6-oxo-5-[5-(1,2,3,4,6-pentahydroxyhexoxy)pentanoylamino]heptyl]-5-(1,2,4,6-tetrahydroxy-3-methylhexoxy)pentanamide |
|---|---|
| PubChem CID | 146352037 |
| Molecular Formula | C30H58N2O14 |
| Molecular Weight | 670.79 g/mol |
| Exact Mass | 670.39 |
| IUPAC Name | N-[(5R)-6-oxo-5-[5-(1,2,3,4,6-pentahydroxyhexoxy)pentanoylamino]heptyl]-5-(1,2,4,6-tetrahydroxy-3-methylhexoxy)pentanamide |
| SMILES | CC(=O)[C@@H](CCCCNC(=O)CCCCOC(O)C(O)C(C)C(O)CCO)NC(=O)CCCCOC(O)C(O)C(O)C(O)CCO |
| InChI | InChI=1S/C30H58N2O14/c1-19(22(36)12-15-33)26(40)29(43)45-17-7-4-10-24(38)31-14-6-3-9-21(20(2)35)32-25(39)11-5-8-18-46-30(44)28(42)27(41)23(37)13-16-34/h19,21-23,26-30,33-34,36-37,40-44H,3-18H2,1-2H3,(H,31,38)(H,32,39)/t19?,21-,22?,23?,26?,27?,28?,29?,30?/m1/s1 |
| InChIKey | UDYOMTZVGUWQLH-YOZJUNRWSA-N |
| XLogP | -2.44 |
| TPSA | 275.80 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.79 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|