C28H52N2O15 — CID 175634620
N-[6-oxo-5-[5-[(E)-1,2,3,4,6-pentahydroxyhex-2-enoxy]pentanoylamino]hexyl]-5-(1,2,3,4,6-pentahydroxyhexoxy)pentanamide (PubChem CID 175634620) has the molecular formula C28H52N2O15 and a molecular weight of 656.72 g/mol. Its IUPAC name is N-[6-oxo-5-[5-[(E)-1,2,3,4,6-pentahydroxyhex-2-enoxy]pentanoylamino]hexyl]-5-(1,2,3,4,6-pentahydroxyhexoxy)pentanamide.
| Compound Name | N-[6-oxo-5-[5-[(E)-1,2,3,4,6-pentahydroxyhex-2-enoxy]pentanoylamino]hexyl]-5-(1,2,3,4,6-pentahydroxyhexoxy)pentanamide |
|---|---|
| PubChem CID | 175634620 |
| Molecular Formula | C28H52N2O15 |
| Molecular Weight | 656.72 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | N-[6-oxo-5-[5-[(E)-1,2,3,4,6-pentahydroxyhex-2-enoxy]pentanoylamino]hexyl]-5-(1,2,3,4,6-pentahydroxyhexoxy)pentanamide |
| SMILES | O=CC(CCCCNC(=O)CCCCOC(O)C(O)C(O)C(O)CCO)NC(=O)CCCCOC(O)/C(O)=C(\O)C(O)CCO |
| InChI | InChI=1S/C28H52N2O15/c31-13-10-19(34)23(38)25(40)27(42)44-15-5-2-8-21(36)29-12-4-1-7-18(17-33)30-22(37)9-3-6-16-45-28(43)26(41)24(39)20(35)11-14-32/h17-20,23,25,27-28,31-32,34-35,38-43H,1-16H2,(H,29,36)(H,30,37)/b26-24+ |
| InChIKey | AVKKEDFTHASJDA-SHHOIMCASA-N |
| XLogP | -2.50 |
| TPSA | 296.03 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.72 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|