C10H15N3O — CID 118351548
2-[2-(3-hydroxy-4-methylphenyl)ethyl]guanidine (PubChem CID 118351548) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-[2-(3-hydroxy-4-methylphenyl)ethyl]guanidine.
| Compound Name | 2-[2-(3-hydroxy-4-methylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 118351548 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 2-[2-(3-hydroxy-4-methylphenyl)ethyl]guanidine |
| SMILES | Cc1ccc(CCN=C(N)N)cc1O |
| InChI | InChI=1S/C10H15N3O/c1-7-2-3-8(6-9(7)14)4-5-13-10(11)12/h2-3,6,14H,4-5H2,1H3,(H4,11,12,13) |
| InChIKey | HAVZRIFVNXVDTF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|