C30H45N9 — CID 159713930
2-[2-(2-methylphenyl)ethyl]guanidine;2-[2-(3-methylphenyl)ethyl]guanidine;2-[2-(4-methylphenyl)ethyl]guanidine (PubChem CID 159713930) has the molecular formula C30H45N9 and a molecular weight of 531.75 g/mol. Its IUPAC name is 2-[2-(2-methylphenyl)ethyl]guanidine;2-[2-(3-methylphenyl)ethyl]guanidine;2-[2-(4-methylphenyl)ethyl]guanidine.
| Compound Name | 2-[2-(2-methylphenyl)ethyl]guanidine;2-[2-(3-methylphenyl)ethyl]guanidine;2-[2-(4-methylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 159713930 |
| Molecular Formula | C30H45N9 |
| Molecular Weight | 531.75 g/mol |
| Exact Mass | 531.38 |
| IUPAC Name | 2-[2-(2-methylphenyl)ethyl]guanidine;2-[2-(3-methylphenyl)ethyl]guanidine;2-[2-(4-methylphenyl)ethyl]guanidine |
| SMILES | Cc1ccc(CCN=C(N)N)cc1.Cc1cccc(CCN=C(N)N)c1.Cc1ccccc1CCN=C(N)N |
| InChI | InChI=1S/3C10H15N3/c1-8-2-4-9(5-3-8)6-7-13-10(11)12;1-8-3-2-4-9(7-8)5-6-13-10(11)12;1-8-4-2-3-5-9(8)6-7-13-10(11)12/h2-5H,6-7H2,1H3,(H4,11,12,13);2-4,7H,5-6H2,1H3,(H4,11,12,13);2-5H,6-7H2,1H3,(H4,11,12,13) |
| InChIKey | MZENQYZXORIVRJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 193.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.75 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|