C12H11NO2S2 — CID 118352312
1-[2-(3-methoxyphenyl)sulfanyl-1,3-thiazol-5-yl]ethanone (PubChem CID 118352312) has the molecular formula C12H11NO2S2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-[2-(3-methoxyphenyl)sulfanyl-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(3-methoxyphenyl)sulfanyl-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 118352312 |
| Molecular Formula | C12H11NO2S2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 1-[2-(3-methoxyphenyl)sulfanyl-1,3-thiazol-5-yl]ethanone |
| SMILES | COc1cccc(Sc2ncc(C(C)=O)s2)c1 |
| InChI | InChI=1S/C12H11NO2S2/c1-8(14)11-7-13-12(17-11)16-10-5-3-4-9(6-10)15-2/h3-7H,1-2H3 |
| InChIKey | YGWLWJKVVXKSTE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|