C15H9ClF2N4O — CID 118355479
2-chloro-N-[1-(2,6-difluorophenyl)-1,2,4-triazol-3-yl]benzamide (PubChem CID 118355479) has the molecular formula C15H9ClF2N4O and a molecular weight of 334.71 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,6-difluorophenyl)-1,2,4-triazol-3-yl]benzamide.
| Compound Name | 2-chloro-N-[1-(2,6-difluorophenyl)-1,2,4-triazol-3-yl]benzamide |
|---|---|
| PubChem CID | 118355479 |
| Molecular Formula | C15H9ClF2N4O |
| Molecular Weight | 334.71 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-chloro-N-[1-(2,6-difluorophenyl)-1,2,4-triazol-3-yl]benzamide |
| SMILES | O=C(Nc1ncn(-c2c(F)cccc2F)n1)c1ccccc1Cl |
| InChI | InChI=1S/C15H9ClF2N4O/c16-10-5-2-1-4-9(10)14(23)20-15-19-8-22(21-15)13-11(17)6-3-7-12(13)18/h1-8H,(H,20,21,23) |
| InChIKey | OWOMZMHGBOGKAB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.71 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |