C18H16ClN3O — CID 90096262
2-chloro-N-[1-(2,6-dimethylphenyl)pyrazol-3-yl]benzamide (PubChem CID 90096262) has the molecular formula C18H16ClN3O and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,6-dimethylphenyl)pyrazol-3-yl]benzamide.
| Compound Name | 2-chloro-N-[1-(2,6-dimethylphenyl)pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 90096262 |
| Molecular Formula | C18H16ClN3O |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-chloro-N-[1-(2,6-dimethylphenyl)pyrazol-3-yl]benzamide |
| SMILES | Cc1cccc(C)c1-n1ccc(NC(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C18H16ClN3O/c1-12-6-5-7-13(2)17(12)22-11-10-16(21-22)20-18(23)14-8-3-4-9-15(14)19/h3-11H,1-2H3,(H,20,21,23) |
| InChIKey | MFDYWNZEEMPRDL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |