C27H46N6O — CID 118360882
N-[4,6-bis(dicyclohexylamino)-1,3,5-triazin-2-yl]hydroxylamine (PubChem CID 118360882) has the molecular formula C27H46N6O and a molecular weight of 470.71 g/mol. Its IUPAC name is N-[4,6-bis(dicyclohexylamino)-1,3,5-triazin-2-yl]hydroxylamine.
| Compound Name | N-[4,6-bis(dicyclohexylamino)-1,3,5-triazin-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 118360882 |
| Molecular Formula | C27H46N6O |
| Molecular Weight | 470.71 g/mol |
| Exact Mass | 470.37 |
| IUPAC Name | N-[4,6-bis(dicyclohexylamino)-1,3,5-triazin-2-yl]hydroxylamine |
| SMILES | ONc1nc(N(C2CCCCC2)C2CCCCC2)nc(N(C2CCCCC2)C2CCCCC2)n1 |
| InChI | InChI=1S/C27H46N6O/c34-31-25-28-26(32(21-13-5-1-6-14-21)22-15-7-2-8-16-22)30-27(29-25)33(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h21-24,34H,1-20H2,(H,28,29,30,31) |
| InChIKey | SLACHKFXTBPLFQ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.71 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|