C7H15N3O2S — CID 118362435
3-[2-(diaminomethylideneamino)ethylsulfanyl]butanoic acid (PubChem CID 118362435) has the molecular formula C7H15N3O2S and a molecular weight of 205.28 g/mol. Its IUPAC name is 3-[2-(diaminomethylideneamino)ethylsulfanyl]butanoic acid.
| Compound Name | 3-[2-(diaminomethylideneamino)ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 118362435 |
| Molecular Formula | C7H15N3O2S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-[2-(diaminomethylideneamino)ethylsulfanyl]butanoic acid |
| SMILES | CC(CC(=O)O)SCCN=C(N)N |
| InChI | InChI=1S/C7H15N3O2S/c1-5(4-6(11)12)13-3-2-10-7(8)9/h5H,2-4H2,1H3,(H,11,12)(H4,8,9,10) |
| InChIKey | PHHJCOACZNQINO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|