C7H15N3O2S2 — CID 87535398
3-[2-(diaminomethylideneamino)ethylsulfanyl]-4-sulfanylbutanoic acid (PubChem CID 87535398) has the molecular formula C7H15N3O2S2 and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-[2-(diaminomethylideneamino)ethylsulfanyl]-4-sulfanylbutanoic acid.
| Compound Name | 3-[2-(diaminomethylideneamino)ethylsulfanyl]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 87535398 |
| Molecular Formula | C7H15N3O2S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-[2-(diaminomethylideneamino)ethylsulfanyl]-4-sulfanylbutanoic acid |
| SMILES | NC(N)=NCCSC(CS)CC(=O)O |
| InChI | InChI=1S/C7H15N3O2S2/c8-7(9)10-1-2-14-5(4-13)3-6(11)12/h5,13H,1-4H2,(H,11,12)(H4,8,9,10) |
| InChIKey | ZFKGLKGQGZFPPL-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|