C18H37N3O3 — CID 122554434
17-(diaminomethylideneamino)-3-hydroxyheptadecanoic acid (PubChem CID 122554434) has the molecular formula C18H37N3O3 and a molecular weight of 343.51 g/mol. Its IUPAC name is 17-(diaminomethylideneamino)-3-hydroxyheptadecanoic acid.
| Compound Name | 17-(diaminomethylideneamino)-3-hydroxyheptadecanoic acid |
|---|---|
| PubChem CID | 122554434 |
| Molecular Formula | C18H37N3O3 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.28 |
| IUPAC Name | 17-(diaminomethylideneamino)-3-hydroxyheptadecanoic acid |
| SMILES | NC(N)=NCCCCCCCCCCCCCCC(O)CC(=O)O |
| InChI | InChI=1S/C18H37N3O3/c19-18(20)21-14-12-10-8-6-4-2-1-3-5-7-9-11-13-16(22)15-17(23)24/h16,22H,1-15H2,(H,23,24)(H4,19,20,21) |
| InChIKey | HETNFSUXJKTJNP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|