C14H26N4O4 — CID 19011407
3-amino-13-(diaminomethylideneamino)-4,5-dioxotridecanoic acid (PubChem CID 19011407) has the molecular formula C14H26N4O4 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-amino-13-(diaminomethylideneamino)-4,5-dioxotridecanoic acid.
| Compound Name | 3-amino-13-(diaminomethylideneamino)-4,5-dioxotridecanoic acid |
|---|---|
| PubChem CID | 19011407 |
| Molecular Formula | C14H26N4O4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 3-amino-13-(diaminomethylideneamino)-4,5-dioxotridecanoic acid |
| SMILES | NC(N)=NCCCCCCCCC(=O)C(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C14H26N4O4/c15-10(9-12(20)21)13(22)11(19)7-5-3-1-2-4-6-8-18-14(16)17/h10H,1-9,15H2,(H,20,21)(H4,16,17,18) |
| InChIKey | VXKOYUBIXBCGDZ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 161.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|