C27H24F3N3O2 — CID 118371946
N,N,3-trimethyl-5-[5-[1,1,1-trifluoro-2-(2-methyl-1,3-benzoxazol-5-yl)propan-2-yl]-1,3-benzoxazol-2-yl]aniline (PubChem CID 118371946) has the molecular formula C27H24F3N3O2 and a molecular weight of 479.50 g/mol. Its IUPAC name is N,N,3-trimethyl-5-[5-[1,1,1-trifluoro-2-(2-methyl-1,3-benzoxazol-5-yl)propan-2-yl]-1,3-benzoxazol-2-yl]aniline.
| Compound Name | N,N,3-trimethyl-5-[5-[1,1,1-trifluoro-2-(2-methyl-1,3-benzoxazol-5-yl)propan-2-yl]-1,3-benzoxazol-2-yl]aniline |
|---|---|
| PubChem CID | 118371946 |
| Molecular Formula | C27H24F3N3O2 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | N,N,3-trimethyl-5-[5-[1,1,1-trifluoro-2-(2-methyl-1,3-benzoxazol-5-yl)propan-2-yl]-1,3-benzoxazol-2-yl]aniline |
| SMILES | Cc1cc(-c2nc3cc(C(C)(c4ccc5oc(C)nc5c4)C(F)(F)F)ccc3o2)cc(N(C)C)c1 |
| InChI | InChI=1S/C27H24F3N3O2/c1-15-10-17(12-20(11-15)33(4)5)25-32-22-14-19(7-9-24(22)35-25)26(3,27(28,29)30)18-6-8-23-21(13-18)31-16(2)34-23/h6-14H,1-5H3 |
| InChIKey | RAOYHBKMSFWHTI-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 55.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |