C37H36O9 — CID 118372786
1-O-benzyl 6-O-[2-[3-(methoxymethoxy)-4-phenylmethoxyphenyl]-4-oxo-2,3-dihydrochromen-3-yl] hexanedioate (PubChem CID 118372786) has the molecular formula C37H36O9 and a molecular weight of 624.69 g/mol. Its IUPAC name is 1-O-benzyl 6-O-[2-[3-(methoxymethoxy)-4-phenylmethoxyphenyl]-4-oxo-2,3-dihydrochromen-3-yl] hexanedioate.
| Compound Name | 1-O-benzyl 6-O-[2-[3-(methoxymethoxy)-4-phenylmethoxyphenyl]-4-oxo-2,3-dihydrochromen-3-yl] hexanedioate |
|---|---|
| PubChem CID | 118372786 |
| Molecular Formula | C37H36O9 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | 1-O-benzyl 6-O-[2-[3-(methoxymethoxy)-4-phenylmethoxyphenyl]-4-oxo-2,3-dihydrochromen-3-yl] hexanedioate |
| SMILES | COCOc1cc(C2Oc3ccccc3C(=O)C2OC(=O)CCCCC(=O)OCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C37H36O9/c1-41-25-44-32-22-28(20-21-31(32)42-23-26-12-4-2-5-13-26)36-37(35(40)29-16-8-9-17-30(29)45-36)46-34(39)19-11-10-18-33(38)43-24-27-14-6-3-7-15-27/h2-9,12-17,20-22,36-37H,10-11,18-19,23-25H2,1H3 |
| InChIKey | HATJTTULBIGFTQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|