C33H41N7O6S — CID 118374254
tert-butyl N-[[3-[2-[[5-[4-[6-[(2,3-dihydroxy-2-phenylpropanoyl)amino]-1,2-dihydropyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]phenyl]methyl]carbamate (PubChem CID 118374254) has the molecular formula C33H41N7O6S and a molecular weight of 663.80 g/mol. Its IUPAC name is tert-butyl N-[[3-[2-[[5-[4-[6-[(2,3-dihydroxy-2-phenylpropanoyl)amino]-1,2-dihydropyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[2-[[5-[4-[6-[(2,3-dihydroxy-2-phenylpropanoyl)amino]-1,2-dihydropyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 118374254 |
| Molecular Formula | C33H41N7O6S |
| Molecular Weight | 663.80 g/mol |
| Exact Mass | 663.28 |
| IUPAC Name | tert-butyl N-[[3-[2-[[5-[4-[6-[(2,3-dihydroxy-2-phenylpropanoyl)amino]-1,2-dihydropyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoethyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(CC(=O)Nc2nnc(CCCCC3=CC=C(NC(=O)C(O)(CO)c4ccccc4)NN3)s2)c1 |
| InChI | InChI=1S/C33H41N7O6S/c1-32(2,3)46-31(44)34-20-23-11-9-10-22(18-23)19-27(42)36-30-40-39-28(47-30)15-8-7-14-25-16-17-26(38-37-25)35-29(43)33(45,21-41)24-12-5-4-6-13-24/h4-6,9-13,16-18,37-38,41,45H,7-8,14-15,19-21H2,1-3H3,(H,34,44)(H,35,43)(H,36,40,42) |
| InChIKey | ZYVIHCMTHFWUKZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 186.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|