C33H43N7O3S — CID 155261339
2-methyl-N-[1-[3-[2-[[6-[4-[5-[[2-(6-methylcyclohexa-2,4-dien-1-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]-1,2-dihydropyridazin-3-yl]amino]-2-oxoethyl]phenyl]ethyl]propanamide (PubChem CID 155261339) has the molecular formula C33H43N7O3S and a molecular weight of 617.82 g/mol. Its IUPAC name is 2-methyl-N-[1-[3-[2-[[6-[4-[5-[[2-(6-methylcyclohexa-2,4-dien-1-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]-1,2-dihydropyridazin-3-yl]amino]-2-oxoethyl]phenyl]ethyl]propanamide.
| Compound Name | 2-methyl-N-[1-[3-[2-[[6-[4-[5-[[2-(6-methylcyclohexa-2,4-dien-1-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]-1,2-dihydropyridazin-3-yl]amino]-2-oxoethyl]phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 155261339 |
| Molecular Formula | C33H43N7O3S |
| Molecular Weight | 617.82 g/mol |
| Exact Mass | 617.31 |
| IUPAC Name | 2-methyl-N-[1-[3-[2-[[6-[4-[5-[[2-(6-methylcyclohexa-2,4-dien-1-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]-1,2-dihydropyridazin-3-yl]amino]-2-oxoethyl]phenyl]ethyl]propanamide |
| SMILES | CC(C)C(=O)NC(C)c1cccc(CC(=O)NC2=CC=C(CCCCc3nnc(NC(=O)CC4C=CC=CC4C)s3)NN2)c1 |
| InChI | InChI=1S/C33H43N7O3S/c1-21(2)32(43)34-23(4)26-13-9-11-24(18-26)19-29(41)35-28-17-16-27(37-38-28)14-7-8-15-31-39-40-33(44-31)36-30(42)20-25-12-6-5-10-22(25)3/h5-6,9-13,16-18,21-23,25,37-38H,7-8,14-15,19-20H2,1-4H3,(H,34,43)(H,35,41)(H,36,40,42) |
| InChIKey | DLWCMEFRURJCMV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.82 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|