C17H21N9O3 — CID 118374530
4-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]-N-hydroxybutanamide (PubChem CID 118374530) has the molecular formula C17H21N9O3 and a molecular weight of 399.42 g/mol. Its IUPAC name is 4-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]-N-hydroxybutanamide.
| Compound Name | 4-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 118374530 |
| Molecular Formula | C17H21N9O3 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-[6-(2-aminopyrimidin-5-yl)-2-morpholin-4-ylpurin-9-yl]-N-hydroxybutanamide |
| SMILES | Nc1ncc(-c2nc(N3CCOCC3)nc3c2ncn3CCCC(=O)NO)cn1 |
| InChI | InChI=1S/C17H21N9O3/c18-16-19-8-11(9-20-16)13-14-15(23-17(22-13)25-4-6-29-7-5-25)26(10-21-14)3-1-2-12(27)24-28/h8-10,28H,1-7H2,(H,24,27)(H2,18,19,20) |
| InChIKey | MCKWUNRIELAJTF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|