C13H26O2 — CID 118374858
3-methylbutyl 2,3,4-trimethylpentanoate (PubChem CID 118374858) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 3-methylbutyl 2,3,4-trimethylpentanoate.
| Compound Name | 3-methylbutyl 2,3,4-trimethylpentanoate |
|---|---|
| PubChem CID | 118374858 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 3-methylbutyl 2,3,4-trimethylpentanoate |
| SMILES | CC(C)CCOC(=O)C(C)C(C)C(C)C |
| InChI | InChI=1S/C13H26O2/c1-9(2)7-8-15-13(14)12(6)11(5)10(3)4/h9-12H,7-8H2,1-6H3 |
| InChIKey | MRYQTQHBYHFEAJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |