C11H22N2O3 — CID 177053282
[(2R)-2,3-diamino-3-oxopropyl] (2R,3R)-2,3,4-trimethylpentanoate (PubChem CID 177053282) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is [(2R)-2,3-diamino-3-oxopropyl] (2R,3R)-2,3,4-trimethylpentanoate.
| Compound Name | [(2R)-2,3-diamino-3-oxopropyl] (2R,3R)-2,3,4-trimethylpentanoate |
|---|---|
| PubChem CID | 177053282 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | [(2R)-2,3-diamino-3-oxopropyl] (2R,3R)-2,3,4-trimethylpentanoate |
| SMILES | CC(C)[C@@H](C)[C@@H](C)C(=O)OC[C@@H](N)C(N)=O |
| InChI | InChI=1S/C11H22N2O3/c1-6(2)7(3)8(4)11(15)16-5-9(12)10(13)14/h6-9H,5,12H2,1-4H3,(H2,13,14)/t7-,8-,9-/m1/s1 |
| InChIKey | NHQIJSCSTDJFQN-IWSPIJDZSA-N |
| XLogP | 0.27 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |