3-carbamoyl-4,5-dimethylhexanoic acid

C9H17NO3 — CID 145216564

IUPAC3-carbamoyl-4,5-dimethylhexanoic acid
SMILESCC(C)C(C)C(CC(=O)O)C(N)=O
InChIInChI=1S/C9H17NO3/c1-5(2)6(3)7(9(10)13)4-8(11)12/h5-7H,4H2,1-3H3,(H2,10,13)(H,11,12)
InChIKeyQMJFHIQHFVMCFA-UHFFFAOYSA-N
MW187.24 g/mol
LogP0.85
Rot. Bonds5

About 3-carbamoyl-4,5-dimethylhexanoic acid

3-carbamoyl-4,5-dimethylhexanoic acid (PubChem CID 145216564) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 3-carbamoyl-4,5-dimethylhexanoic acid.

Molecular Properties

Compound Name3-carbamoyl-4,5-dimethylhexanoic acid
PubChem CID145216564
Molecular FormulaC9H17NO3
Molecular Weight187.24 g/mol
Exact Mass187.12
IUPAC Name3-carbamoyl-4,5-dimethylhexanoic acid
SMILESCC(C)C(C)C(CC(=O)O)C(N)=O
InChIInChI=1S/C9H17NO3/c1-5(2)6(3)7(9(10)13)4-8(11)12/h5-7H,4H2,1-3H3,(H2,10,13)(H,11,12)
InChIKeyQMJFHIQHFVMCFA-UHFFFAOYSA-N
XLogP0.85
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.24
LogP ≤ 50.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-carbamoyl-4,5-dimethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-carbamoyl-4,5-dimethylhexanoic acid?
The IUPAC name of 3-carbamoyl-4,5-dimethylhexanoic acid (CID 145216564) is 3-carbamoyl-4,5-dimethylhexanoic acid.
What is the SMILES notation for 3-carbamoyl-4,5-dimethylhexanoic acid?
The canonical SMILES for 3-carbamoyl-4,5-dimethylhexanoic acid is CC(C)C(C)C(CC(=O)O)C(N)=O.
What is the InChIKey of 3-carbamoyl-4,5-dimethylhexanoic acid?
The InChIKey is QMJFHIQHFVMCFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-5(2)6(3)7(9(10)13)4-8(11)12/h5-7H,4H2,1-3H3,(H2,10,13)(H,11,12).
What are the key properties of 3-carbamoyl-4,5-dimethylhexanoic acid?
3-carbamoyl-4,5-dimethylhexanoic acid has a molecular weight of 187.24 g/mol, XLogP of 0.85, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carbamoyl-4,5-dimethylhexanoic acid is sourced from PubChem (CID 145216564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).