C20H34FN3O3S — CID 118376793
N-[5-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluoroanilino]pentyl]propane-2-sulfonamide (PubChem CID 118376793) has the molecular formula C20H34FN3O3S and a molecular weight of 415.58 g/mol. Its IUPAC name is N-[5-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluoroanilino]pentyl]propane-2-sulfonamide.
| Compound Name | N-[5-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluoroanilino]pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 118376793 |
| Molecular Formula | C20H34FN3O3S |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-[5-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluoroanilino]pentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCCCCNc1ccc(F)cc1N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C20H34FN3O3S/c1-15(2)28(25,26)23-11-7-5-6-10-22-19-9-8-18(21)12-20(19)24-13-16(3)27-17(4)14-24/h8-9,12,15-17,22-23H,5-7,10-11,13-14H2,1-4H3/t16-,17+ |
| InChIKey | QVGMJYNQPYPXKJ-CALCHBBNSA-N |
| XLogP | 3.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|